![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Manual of Administration.pdf | 2022-02-16 12:53 | 1.3M | |
| Vol 01 Grammatical Structure Quizzes Less 01-44.pdf | 2022-02-16 12:53 | 10M | |
| Vol 02 Grammatical Structures 01 Less 01-14.pdf | 2022-02-16 12:53 | 9.0M | |
| Vol 03 Grammatical Structures 02 Less 15-26.pdf | 2022-02-16 12:53 | 10M | |
| Vol 04 Grammatical Structures 03 Less 27-38.pdf | 2022-02-16 12:53 | 10M | |
| Vol 05 Grammatical Structures 05 Less 39-44.pdf | 2022-02-16 12:53 | 5.2M | |
| Vol 06 Grammatical Terms.pdf | 2022-02-16 12:53 | 642K | |
| Vol 07 Basic Situations 01.pdf | 2022-02-16 12:53 | 10M | |
| Vol 08 Basic Situations 02.pdf | 2022-02-16 12:53 | 5.0M | |
| Vol 09 Area Background Studies 01.pdf | 2022-02-16 12:53 | 7.7M | |
| Vol 10 Area Background Studies 02.pdf | 2022-02-16 12:53 | 7.1M | |
| Vol 11 Military Operation Terminology.pdf | 2022-02-16 12:53 | 6.9M | |
| Vol 12 East German Land and Air Forces.pdf | 2022-02-16 12:53 | 4.5M | |
| Vol 13 FM 100-5, English-German.pdf | 2022-02-16 12:53 | 37M | |
| Vol 14 Keys - Volumes 11 and 12.pdf | 2022-02-16 12:53 | 1.4M | |